C68H66N2 — CID 167415284
N-[5-tert-butyl-2-[5-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-carbazol-9-yl-N-phenylpyren-1-amine (PubChem CID 167415284) has the molecular formula C68H66N2 and a molecular weight of 911.29 g/mol. Its IUPAC name is N-[5-tert-butyl-2-[5-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-carbazol-9-yl-N-phenylpyren-1-amine.
| Compound Name | N-[5-tert-butyl-2-[5-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-carbazol-9-yl-N-phenylpyren-1-amine |
|---|---|
| PubChem CID | 167415284 |
| Molecular Formula | C68H66N2 |
| Molecular Weight | 911.29 g/mol |
| Exact Mass | 910.52 |
| IUPAC Name | N-[5-tert-butyl-2-[5-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-carbazol-9-yl-N-phenylpyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc(C(C)(C)C)cc2-c2ccc(C(C)(C)C)cc2N(c2ccccc2)c2ccc3ccc4c(-n5c6ccccc6c6ccccc65)ccc5ccc2c3c54)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H66N2/c1-65(2,3)46-30-34-51(45-38-48(67(7,8)9)40-49(39-45)68(10,11)12)57(41-46)54-35-31-47(66(4,5)6)42-62(54)69(50-20-14-13-15-21-50)60-36-28-43-27-33-56-61(37-29-44-26-32-55(60)63(43)64(44)56)70-58-24-18-16-22-52(58)53-23-17-19-25-59(53)70/h13-42H,1-12H3 |
| InChIKey | RFCHUDTUZOHBHT-UHFFFAOYSA-N |
| XLogP | 19.67 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.29 |
| LogP ≤ 5 | 19.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|