C76H82N2 — CID 167415778
N-[3-tert-butyl-5-(3,5-ditert-butylphenyl)phenyl]-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]-6-carbazol-9-ylpyren-1-amine (PubChem CID 167415778) has the molecular formula C76H82N2 and a molecular weight of 1023.51 g/mol. Its IUPAC name is N-[3-tert-butyl-5-(3,5-ditert-butylphenyl)phenyl]-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]-6-carbazol-9-ylpyren-1-amine.
| Compound Name | N-[3-tert-butyl-5-(3,5-ditert-butylphenyl)phenyl]-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]-6-carbazol-9-ylpyren-1-amine |
|---|---|
| PubChem CID | 167415778 |
| Molecular Formula | C76H82N2 |
| Molecular Weight | 1023.51 g/mol |
| Exact Mass | 1022.65 |
| IUPAC Name | N-[3-tert-butyl-5-(3,5-ditert-butylphenyl)phenyl]-N-[4-tert-butyl-2-(3,5-ditert-butylphenyl)phenyl]-6-carbazol-9-ylpyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(N(c2ccc(C(C)(C)C)cc2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccc3ccc4c(-n5c6ccccc6c6ccccc65)ccc5ccc2c3c54)c1 |
| InChI | InChI=1S/C76H82N2/c1-71(2,3)52-31-36-68(63(46-52)51-40-55(74(10,11)12)44-56(41-51)75(13,14)15)77(58-42-50(39-57(45-58)76(16,17)18)49-37-53(72(4,5)6)43-54(38-49)73(7,8)9)66-34-29-47-28-33-62-67(35-30-48-27-32-61(66)69(47)70(48)62)78-64-25-21-19-23-59(64)60-24-20-22-26-65(60)78/h19-46H,1-18H3 |
| InChIKey | ZLWGGRWQATVDAW-UHFFFAOYSA-N |
| XLogP | 22.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.51 |
| LogP ≤ 5 | 22.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|