C80H74N2 — CID 167415317
N-[5-tert-butyl-2-(3-tert-butyl-5-phenylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine (PubChem CID 167415317) has the molecular formula C80H74N2 and a molecular weight of 1063.49 g/mol. Its IUPAC name is N-[5-tert-butyl-2-(3-tert-butyl-5-phenylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine.
| Compound Name | N-[5-tert-butyl-2-(3-tert-butyl-5-phenylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine |
|---|---|
| PubChem CID | 167415317 |
| Molecular Formula | C80H74N2 |
| Molecular Weight | 1063.49 g/mol |
| Exact Mass | 1062.59 |
| IUPAC Name | N-[5-tert-butyl-2-(3-tert-butyl-5-phenylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-c2ccc(C(C)(C)C)cc2N(c2ccc(-c3cccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)cc2)c2ccc3ccc4c(-n5c6ccccc6c6ccccc65)ccc5ccc2c3c54)c1 |
| InChI | InChI=1S/C80H74N2/c1-77(2,3)60-35-40-65(59-44-57(51-21-14-13-15-22-51)45-61(48-59)78(4,5)6)74(50-60)81(64-36-29-52(30-37-64)55-23-20-24-56(43-55)58-46-62(79(7,8)9)49-63(47-58)80(10,11)12)72-41-33-53-32-39-69-73(42-34-54-31-38-68(72)75(53)76(54)69)82-70-27-18-16-25-66(70)67-26-17-19-28-71(67)82/h13-50H,1-12H3 |
| InChIKey | TXJAYWJPQBHBAX-UHFFFAOYSA-N |
| XLogP | 23.01 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.49 |
| LogP ≤ 5 | 23.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|