C88H90N2 — CID 167414810
6-[3,6-bis(3,5-ditert-butylphenyl)carbazol-9-yl]-N-(3-tert-butyl-4-phenylphenyl)-N-(5-tert-butyl-2-phenylphenyl)pyren-1-amine (PubChem CID 167414810) has the molecular formula C88H90N2 and a molecular weight of 1175.70 g/mol. Its IUPAC name is 6-[3,6-bis(3,5-ditert-butylphenyl)carbazol-9-yl]-N-(3-tert-butyl-4-phenylphenyl)-N-(5-tert-butyl-2-phenylphenyl)pyren-1-amine.
| Compound Name | 6-[3,6-bis(3,5-ditert-butylphenyl)carbazol-9-yl]-N-(3-tert-butyl-4-phenylphenyl)-N-(5-tert-butyl-2-phenylphenyl)pyren-1-amine |
|---|---|
| PubChem CID | 167414810 |
| Molecular Formula | C88H90N2 |
| Molecular Weight | 1175.70 g/mol |
| Exact Mass | 1174.71 |
| IUPAC Name | 6-[3,6-bis(3,5-ditert-butylphenyl)carbazol-9-yl]-N-(3-tert-butyl-4-phenylphenyl)-N-(5-tert-butyl-2-phenylphenyl)pyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)c2cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)ccc2n3-c2ccc3ccc4c(N(c5ccc(-c6ccccc6)c(C(C)(C)C)c5)c5cc(C(C)(C)C)ccc5-c5ccccc5)ccc5ccc2c3c54)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C88H90N2/c1-83(2,3)63-35-39-70(56-27-23-20-24-28-56)80(53-63)89(68-36-40-69(55-25-21-19-22-26-55)75(54-68)88(16,17)18)76-41-31-57-30-38-72-77(42-32-58-29-37-71(76)81(57)82(58)72)90-78-43-33-59(61-45-64(84(4,5)6)51-65(46-61)85(7,8)9)49-73(78)74-50-60(34-44-79(74)90)62-47-66(86(10,11)12)52-67(48-62)87(13,14)15/h19-54H,1-18H3 |
| InChIKey | WJHJBBOOCHRSLX-UHFFFAOYSA-N |
| XLogP | 25.60 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.70 |
| LogP ≤ 5 | 25.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|