C84H82N2 — CID 167415297
N-[4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3-(2-phenylphenyl)phenyl]pyren-1-amine (PubChem CID 167415297) has the molecular formula C84H82N2 and a molecular weight of 1119.59 g/mol. Its IUPAC name is N-[4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3-(2-phenylphenyl)phenyl]pyren-1-amine.
| Compound Name | N-[4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3-(2-phenylphenyl)phenyl]pyren-1-amine |
|---|---|
| PubChem CID | 167415297 |
| Molecular Formula | C84H82N2 |
| Molecular Weight | 1119.59 g/mol |
| Exact Mass | 1118.65 |
| IUPAC Name | N-[4-tert-butyl-2-[3-(3,5-ditert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3-(2-phenylphenyl)phenyl]pyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3cc(C(C)(C)C)ccc3N(c3cccc(-c4ccccc4-c4ccccc4)c3)c3ccc4ccc5c(-n6c7ccc(C(C)(C)C)cc7c7cc(C(C)(C)C)ccc76)ccc6ccc3c4c65)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C84H82N2/c1-80(2,3)60-35-42-75(70(50-60)57-26-21-25-56(45-57)59-46-63(83(10,11)12)49-64(47-59)84(13,14)15)85(65-28-22-27-58(48-65)67-30-20-19-29-66(67)53-23-17-16-18-24-53)73-40-33-54-32-39-69-74(41-34-55-31-38-68(73)78(54)79(55)69)86-76-43-36-61(81(4,5)6)51-71(76)72-52-62(82(7,8)9)37-44-77(72)86/h16-52H,1-15H3 |
| InChIKey | GQLNXXNWFYOMQD-UHFFFAOYSA-N |
| XLogP | 24.31 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.59 |
| LogP ≤ 5 | 24.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|