C64H58N2 — CID 167415757
N-[4-(4-tert-butylphenyl)phenyl]-6-carbazol-9-yl-N-[3-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine (PubChem CID 167415757) has the molecular formula C64H58N2 and a molecular weight of 855.18 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)phenyl]-6-carbazol-9-yl-N-[3-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine.
| Compound Name | N-[4-(4-tert-butylphenyl)phenyl]-6-carbazol-9-yl-N-[3-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine |
|---|---|
| PubChem CID | 167415757 |
| Molecular Formula | C64H58N2 |
| Molecular Weight | 855.18 g/mol |
| Exact Mass | 854.46 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)phenyl]-6-carbazol-9-yl-N-[3-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(N(c3cccc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)c3ccc4ccc5c(-n6c7ccccc7c7ccccc76)ccc6ccc3c4c65)cc2)cc1 |
| InChI | InChI=1S/C64H58N2/c1-62(2,3)47-29-21-41(22-30-47)42-23-31-50(32-24-42)65(51-16-14-15-45(39-51)46-37-48(63(4,5)6)40-49(38-46)64(7,8)9)58-35-27-43-26-34-55-59(36-28-44-25-33-54(58)60(43)61(44)55)66-56-19-12-10-17-52(56)53-18-11-13-20-57(53)66/h10-40H,1-9H3 |
| InChIKey | GHMNFHCYHLPBLW-UHFFFAOYSA-N |
| XLogP | 18.38 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.18 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|