C74H70N2 — CID 167415639
N-[4-(4-tert-butylphenyl)phenyl]-N-[3-[3-(4-tert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)pyren-1-amine (PubChem CID 167415639) has the molecular formula C74H70N2 and a molecular weight of 987.39 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)phenyl]-N-[3-[3-(4-tert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)pyren-1-amine.
| Compound Name | N-[4-(4-tert-butylphenyl)phenyl]-N-[3-[3-(4-tert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)pyren-1-amine |
|---|---|
| PubChem CID | 167415639 |
| Molecular Formula | C74H70N2 |
| Molecular Weight | 987.39 g/mol |
| Exact Mass | 986.55 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)phenyl]-N-[3-[3-(4-tert-butylphenyl)phenyl]phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)pyren-1-amine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(N(c3cccc(-c4cccc(-c5ccc(C(C)(C)C)cc5)c4)c3)c3ccc4ccc5c(-n6c7ccc(C(C)(C)C)cc7c7cc(C(C)(C)C)ccc76)ccc6ccc3c4c65)cc2)cc1 |
| InChI | InChI=1S/C74H70N2/c1-71(2,3)55-29-19-47(20-30-55)48-23-35-59(36-24-48)75(60-18-14-17-54(44-60)53-16-13-15-52(43-53)49-21-31-56(32-22-49)72(4,5)6)65-39-27-50-26-38-62-66(40-28-51-25-37-61(65)69(50)70(51)62)76-67-41-33-57(73(7,8)9)45-63(67)64-46-58(74(10,11)12)34-42-68(64)76/h13-46H,1-12H3 |
| InChIKey | MIJIQZHCCDFTSE-UHFFFAOYSA-N |
| XLogP | 21.34 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.39 |
| LogP ≤ 5 | 21.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|