C74H62N2 — CID 167414983
N-[3,5-bis(4-methylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[4-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine (PubChem CID 167414983) has the molecular formula C74H62N2 and a molecular weight of 979.32 g/mol. Its IUPAC name is N-[3,5-bis(4-methylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[4-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine.
| Compound Name | N-[3,5-bis(4-methylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[4-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine |
|---|---|
| PubChem CID | 167414983 |
| Molecular Formula | C74H62N2 |
| Molecular Weight | 979.32 g/mol |
| Exact Mass | 978.49 |
| IUPAC Name | N-[3,5-bis(4-methylphenyl)phenyl]-6-carbazol-9-yl-N-[4-[4-(3,5-ditert-butylphenyl)phenyl]phenyl]pyren-1-amine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)cc(N(c3ccc(-c4ccc(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc4)cc3)c3ccc4ccc5c(-n6c7ccccc7c7ccccc76)ccc6ccc3c4c65)c2)cc1 |
| InChI | InChI=1S/C74H62N2/c1-47-17-21-51(22-18-47)56-41-57(52-23-19-48(2)20-24-52)45-62(44-56)75(61-35-29-50(30-36-61)49-25-27-53(28-26-49)58-42-59(73(3,4)5)46-60(43-58)74(6,7)8)69-39-33-54-32-38-66-70(40-34-55-31-37-65(69)71(54)72(55)66)76-67-15-11-9-13-63(67)64-14-10-12-16-68(64)76/h9-46H,1-8H3 |
| InChIKey | REEVWVPKLVZQKO-UHFFFAOYSA-N |
| XLogP | 21.03 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.32 |
| LogP ≤ 5 | 21.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|