C18H13ClFN — CID 163209826
2-chloro-3-fluoro-N,N-diphenylaniline (PubChem CID 163209826) has the molecular formula C18H13ClFN and a molecular weight of 297.76 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N,N-diphenylaniline.
| Compound Name | 2-chloro-3-fluoro-N,N-diphenylaniline |
|---|---|
| PubChem CID | 163209826 |
| Molecular Formula | C18H13ClFN |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-chloro-3-fluoro-N,N-diphenylaniline |
| SMILES | Fc1cccc(N(c2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C18H13ClFN/c19-18-16(20)12-7-13-17(18)21(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13H |
| InChIKey | KESOAWAFJOHUDB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |