C9H13Cl2F3N2 — CID 131637048
3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride (PubChem CID 131637048) has the molecular formula C9H13Cl2F3N2 and a molecular weight of 277.12 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride.
| Compound Name | 3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 131637048 |
| Molecular Formula | C9H13Cl2F3N2 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-N,3-N-dimethyl-4-(trifluoromethyl)benzene-1,3-diamine;dihydrochloride |
| SMILES | CN(C)c1cc(N)ccc1C(F)(F)F.Cl.Cl |
| InChI | InChI=1S/C9H11F3N2.2ClH/c1-14(2)8-5-6(13)3-4-7(8)9(10,11)12;;/h3-5H,13H2,1-2H3;2*1H |
| InChIKey | ADOSXDXMLNSSLG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|