C11H12N2O2 — CID 117292430
7-(isocyanatomethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 117292430) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 7-(isocyanatomethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 7-(isocyanatomethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 117292430 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 7-(isocyanatomethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cc(CN=C=O)ccc21 |
| InChI | InChI=1S/C11H12N2O2/c1-13-4-5-15-11-6-9(7-12-8-14)2-3-10(11)13/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | OUVZZKWJZXJKGA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|