C12H17NO2 — CID 83777474
3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-1-ol (PubChem CID 83777474) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-1-ol.
| Compound Name | 3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-1-ol |
|---|---|
| PubChem CID | 83777474 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-1-ol |
| SMILES | CN1CCOc2cc(CCCO)ccc21 |
| InChI | InChI=1S/C12H17NO2/c1-13-6-8-15-12-9-10(3-2-7-14)4-5-11(12)13/h4-5,9,14H,2-3,6-8H2,1H3 |
| InChIKey | IDVQCFLERIQGLO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |