C15H23NO2 — CID 82058002
(4-hexyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanol (PubChem CID 82058002) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (4-hexyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanol.
| Compound Name | (4-hexyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanol |
|---|---|
| PubChem CID | 82058002 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (4-hexyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanol |
| SMILES | CCCCCCN1CCOc2cc(CO)ccc21 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-8-16-9-10-18-15-11-13(12-17)6-7-14(15)16/h6-7,11,17H,2-5,8-10,12H2,1H3 |
| InChIKey | DFSHJQBHRDAIMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|