C17H19NO2 — CID 82058003
[4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methanol (PubChem CID 82058003) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is [4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methanol.
| Compound Name | [4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methanol |
|---|---|
| PubChem CID | 82058003 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methanol |
| SMILES | OCc1ccc2c(c1)OCCN2CCc1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-13-15-6-7-16-17(12-15)20-11-10-18(16)9-8-14-4-2-1-3-5-14/h1-7,12,19H,8-11,13H2 |
| InChIKey | GXZPSLIXBYMYQZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|