C25H28N2O2S — CID 142286525
4-[[[methoxy-[4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methyl]amino]methyl]benzenethiol (PubChem CID 142286525) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-[[[methoxy-[4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methyl]amino]methyl]benzenethiol.
| Compound Name | 4-[[[methoxy-[4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methyl]amino]methyl]benzenethiol |
|---|---|
| PubChem CID | 142286525 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 4-[[[methoxy-[4-(2-phenylethyl)-2,3-dihydro-1,4-benzoxazin-7-yl]methyl]amino]methyl]benzenethiol |
| SMILES | COC(NCc1ccc(S)cc1)c1ccc2c(c1)OCCN2CCc1ccccc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-28-25(26-18-20-7-10-22(30)11-8-20)21-9-12-23-24(17-21)29-16-15-27(23)14-13-19-5-3-2-4-6-19/h2-12,17,25-26,30H,13-16,18H2,1H3 |
| InChIKey | PLENCSQKUHDXOB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|