C25H28N2O2S — CID 142286668
[1-[(2-methoxyphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-[(4-sulfanylphenyl)methylamino]methanol (PubChem CID 142286668) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is [1-[(2-methoxyphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-[(4-sulfanylphenyl)methylamino]methanol.
| Compound Name | [1-[(2-methoxyphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-[(4-sulfanylphenyl)methylamino]methanol |
|---|---|
| PubChem CID | 142286668 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [1-[(2-methoxyphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-[(4-sulfanylphenyl)methylamino]methanol |
| SMILES | COc1ccccc1CN1CCCc2cc(C(O)NCc3ccc(S)cc3)ccc21 |
| InChI | InChI=1S/C25H28N2O2S/c1-29-24-7-3-2-5-21(24)17-27-14-4-6-19-15-20(10-13-23(19)27)25(28)26-16-18-8-11-22(30)12-9-18/h2-3,5,7-13,15,25-26,28,30H,4,6,14,16-17H2,1H3 |
| InChIKey | SXOVYIQKTBJTQM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|