C32H31N3O2 — CID 6140321
N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 6140321) has the molecular formula C32H31N3O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 6140321 |
| Molecular Formula | C32H31N3O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | COc1ccc(/C=N\NC(=O)C(c2ccccc2)c2ccccc2)cc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C32H31N3O2/c1-37-30-19-18-24(21-28(30)23-35-20-10-16-25-11-8-9-17-29(25)35)22-33-34-32(36)31(26-12-4-2-5-13-26)27-14-6-3-7-15-27/h2-9,11-15,17-19,21-22,31H,10,16,20,23H2,1H3,(H,34,36)/b33-22- |
| InChIKey | GZRQSPDMUNQNJQ-NVMPUMLXSA-N |
| XLogP | 5.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|