C26H26ClN3O2 — CID 6140320
2-(4-chlorophenyl)-N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]acetamide (PubChem CID 6140320) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6140320 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)Cc2ccc(Cl)cc2)cc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C26H26ClN3O2/c1-32-25-13-10-20(17-28-29-26(31)16-19-8-11-23(27)12-9-19)15-22(25)18-30-14-4-6-21-5-2-3-7-24(21)30/h2-3,5,7-13,15,17H,4,6,14,16,18H2,1H3,(H,29,31)/b28-17- |
| InChIKey | KWWCQAFKFSEBKV-QRQIAZFYSA-N |
| XLogP | 4.99 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|