C25H24IN3O2 — CID 4525654
N-[[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-3-iodobenzamide (PubChem CID 4525654) has the molecular formula C25H24IN3O2 and a molecular weight of 525.39 g/mol. Its IUPAC name is N-[[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-3-iodobenzamide.
| Compound Name | N-[[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-3-iodobenzamide |
|---|---|
| PubChem CID | 4525654 |
| Molecular Formula | C25H24IN3O2 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-methoxyphenyl]methylideneamino]-3-iodobenzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cccc(I)c2)cc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C25H24IN3O2/c1-31-24-12-11-18(16-27-28-25(30)20-7-4-9-22(26)15-20)14-21(24)17-29-13-5-8-19-6-2-3-10-23(19)29/h2-4,6-7,9-12,14-16H,5,8,13,17H2,1H3,(H,28,30) |
| InChIKey | MWRBJTHVHMRZLO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|