C17H15IN4O2 — CID 45124779
N-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-3-iodobenzamide (PubChem CID 45124779) has the molecular formula C17H15IN4O2 and a molecular weight of 434.24 g/mol. Its IUPAC name is N-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-3-iodobenzamide.
| Compound Name | N-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-3-iodobenzamide |
|---|---|
| PubChem CID | 45124779 |
| Molecular Formula | C17H15IN4O2 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | N-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylideneamino]-3-iodobenzamide |
| SMILES | Cn1c(=O)n(C)c2cc(/C=N/NC(=O)c3cccc(I)c3)ccc21 |
| InChI | InChI=1S/C17H15IN4O2/c1-21-14-7-6-11(8-15(14)22(2)17(21)24)10-19-20-16(23)12-4-3-5-13(18)9-12/h3-10H,1-2H3,(H,20,23)/b19-10+ |
| InChIKey | HNNJMYQRRCBPLH-VXLYETTFSA-N |
| XLogP | 2.25 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|