C19H19IN2O4 — CID 126193130
propan-2-yl 2-[4-[(Z)-[(3-iodobenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126193130) has the molecular formula C19H19IN2O4 and a molecular weight of 466.28 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(Z)-[(3-iodobenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(Z)-[(3-iodobenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126193130 |
| Molecular Formula | C19H19IN2O4 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | propan-2-yl 2-[4-[(Z)-[(3-iodobenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(/C=N\NC(=O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C19H19IN2O4/c1-13(2)26-18(23)12-25-17-8-6-14(7-9-17)11-21-22-19(24)15-4-3-5-16(20)10-15/h3-11,13H,12H2,1-2H3,(H,22,24)/b21-11- |
| InChIKey | JBGWXCJBPAZKJH-NHDPSOOVSA-N |
| XLogP | 3.39 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|