C18H22N4O3 — CID 3965917
propan-2-yl 2-[4-[[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3965917) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3965917 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | propan-2-yl 2-[4-[[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1cc(C)nc(NN=Cc2ccc(OCC(=O)OC(C)C)cc2)n1 |
| InChI | InChI=1S/C18H22N4O3/c1-12(2)25-17(23)11-24-16-7-5-15(6-8-16)10-19-22-18-20-13(3)9-14(4)21-18/h5-10,12H,11H2,1-4H3,(H,20,21,22) |
| InChIKey | BPJPFPHGEHZKNN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|