C15H16F2N4O — CID 6163671
N-[(Z)-[4-(2,2-difluoroethoxy)phenyl]methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 6163671) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[(Z)-[4-(2,2-difluoroethoxy)phenyl]methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[4-(2,2-difluoroethoxy)phenyl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 6163671 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[(Z)-[4-(2,2-difluoroethoxy)phenyl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C\c2ccc(OCC(F)F)cc2)n1 |
| InChI | InChI=1S/C15H16F2N4O/c1-10-7-11(2)20-15(19-10)21-18-8-12-3-5-13(6-4-12)22-9-14(16)17/h3-8,14H,9H2,1-2H3,(H,19,20,21)/b18-8- |
| InChIKey | UIBABJNOIPQRSM-LSCVHKIXSA-N |
| XLogP | 3.18 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|