C9H9F2NO2 — CID 50896716
(NE)-N-[[4-(2,2-difluoroethoxy)phenyl]methylidene]hydroxylamine (PubChem CID 50896716) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is (NE)-N-[[4-(2,2-difluoroethoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-(2,2-difluoroethoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 50896716 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (NE)-N-[[4-(2,2-difluoroethoxy)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C9H9F2NO2/c10-9(11)6-14-8-3-1-7(2-4-8)5-12-13/h1-5,9,13H,6H2/b12-5+ |
| InChIKey | LXDPMBJVLKKZER-LFYBBSHMSA-N |
| XLogP | 2.14 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|