C20H22FN3O3 — CID 9272342
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-(3-fluoro-4-methoxyphenyl)acetohydrazide (PubChem CID 9272342) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-(3-fluoro-4-methoxyphenyl)acetohydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-(3-fluoro-4-methoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 9272342 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-(3-fluoro-4-methoxyphenyl)acetohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)CN2CCCc3ccccc32)cc1F |
| InChI | InChI=1S/C20H22FN3O3/c1-27-18-9-8-14(11-16(18)21)12-19(25)22-23-20(26)13-24-10-4-6-15-5-2-3-7-17(15)24/h2-3,5,7-9,11H,4,6,10,12-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | KQAQMOHUJHLULQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|