C24H29N3O4 — CID 9159473
(E)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enehydrazide (PubChem CID 9159473) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is (E)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9159473 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (E)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enehydrazide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NNC(=O)CN2CCCc3ccccc32)cc1OC |
| InChI | InChI=1S/C24H29N3O4/c1-3-15-31-21-12-10-18(16-22(21)30-2)11-13-23(28)25-26-24(29)17-27-14-6-8-19-7-4-5-9-20(19)27/h4-5,7,9-13,16H,3,6,8,14-15,17H2,1-2H3,(H,25,28)(H,26,29)/b13-11+ |
| InChIKey | HOCVJYKEUHDBSQ-ACCUITESSA-N |
| XLogP | 3.10 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|