C19H28N2O4 — CID 51222176
(E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide (PubChem CID 51222176) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51222176 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NCC(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C19H28N2O4/c1-6-11-25-15-9-7-14(12-16(15)24-5)8-10-17(22)20-13-18(23)21-19(2,3)4/h7-10,12H,6,11,13H2,1-5H3,(H,20,22)(H,21,23)/b10-8+ |
| InChIKey | DPIUAVHJHCSEDZ-CSKARUKUSA-N |
| XLogP | 2.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|