C18H21NO3S — CID 29437112
(E)-3-(3-methoxy-4-propoxyphenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 29437112) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-propoxyphenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-propoxyphenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 29437112 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (E)-3-(3-methoxy-4-propoxyphenyl)-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NCc2cccs2)cc1OC |
| InChI | InChI=1S/C18H21NO3S/c1-3-10-22-16-8-6-14(12-17(16)21-2)7-9-18(20)19-13-15-5-4-11-23-15/h4-9,11-12H,3,10,13H2,1-2H3,(H,19,20)/b9-7+ |
| InChIKey | SXTOHAYHIUXVEG-VQHVLOKHSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|