C27H29N3O4 — CID 136720882
(2S)-2-[(2,2-diphenylacetyl)amino]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanamide (PubChem CID 136720882) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 136720882 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (2S)-2-[(2,2-diphenylacetyl)amino]-N-[(Z)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-methylbutanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H](NC(=O)C(c2ccccc2)c2ccccc2)C(C)C)ccc1O |
| InChI | InChI=1S/C27H29N3O4/c1-18(2)25(27(33)30-28-17-19-14-15-22(31)23(16-19)34-3)29-26(32)24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-18,24-25,31H,1-3H3,(H,29,32)(H,30,33)/b28-17-/t25-/m0/s1 |
| InChIKey | TUJILHVAWBJCEA-PFQJNYNCSA-N |
| XLogP | 3.82 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|