C30H29N3O3 — CID 3130698
2-[(2,2-diphenylacetyl)amino]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylbutanamide (PubChem CID 3130698) has the molecular formula C30H29N3O3 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylbutanamide.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 3130698 |
| Molecular Formula | C30H29N3O3 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C30H29N3O3/c1-20(2)28(30(36)33-31-19-25-24-16-10-9-11-21(24)17-18-26(25)34)32-29(35)27(22-12-5-3-6-13-22)23-14-7-4-8-15-23/h3-20,27-28,34H,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | BYRJENHSOIECOX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|