C26H25Cl2N3O2 — CID 27877587
(2S)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide (PubChem CID 27877587) has the molecular formula C26H25Cl2N3O2 and a molecular weight of 482.41 g/mol. Its IUPAC name is (2S)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 27877587 |
| Molecular Formula | C26H25Cl2N3O2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (2S)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-2-[(2,2-diphenylacetyl)amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C26H25Cl2N3O2/c1-17(2)24(26(33)31-29-16-20-14-9-15-21(27)23(20)28)30-25(32)22(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-17,22,24H,1-2H3,(H,30,32)(H,31,33)/b29-16-/t24-/m0/s1 |
| InChIKey | NPXJDTKKPHTPDO-ABZYITTCSA-N |
| XLogP | 5.42 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|