C28H34N2OS — CID 134253886
1-[1-[(2-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-1-[(4-sulfanylphenyl)methylamino]ethanol (PubChem CID 134253886) has the molecular formula C28H34N2OS and a molecular weight of 446.66 g/mol. Its IUPAC name is 1-[1-[(2-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-1-[(4-sulfanylphenyl)methylamino]ethanol.
| Compound Name | 1-[1-[(2-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-1-[(4-sulfanylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 134253886 |
| Molecular Formula | C28H34N2OS |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[1-[(2-propan-2-ylphenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]-1-[(4-sulfanylphenyl)methylamino]ethanol |
| SMILES | CC(C)c1ccccc1CN1CCCc2cc(C(C)(O)NCc3ccc(S)cc3)ccc21 |
| InChI | InChI=1S/C28H34N2OS/c1-20(2)26-9-5-4-7-23(26)19-30-16-6-8-22-17-24(12-15-27(22)30)28(3,31)29-18-21-10-13-25(32)14-11-21/h4-5,7,9-15,17,20,29,31-32H,6,8,16,18-19H2,1-3H3 |
| InChIKey | GNMNUWOGFBROIG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|