C18H20FN3O2 — CID 19787344
1-[[1-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]methyl]-1-hydroxyurea (PubChem CID 19787344) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[[1-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[1-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 19787344 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-[[1-[(2-fluorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-yl]methyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)Cc1ccc2c(c1)CCCN2Cc1ccccc1F |
| InChI | InChI=1S/C18H20FN3O2/c19-16-6-2-1-4-15(16)12-21-9-3-5-14-10-13(7-8-17(14)21)11-22(24)18(20)23/h1-2,4,6-8,10,24H,3,5,9,11-12H2,(H2,20,23) |
| InChIKey | HLONDSCUGYSHAW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|