C16H15BrFN — CID 60644856
1-[(4-bromo-2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline (PubChem CID 60644856) has the molecular formula C16H15BrFN and a molecular weight of 320.21 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 60644856 |
| Molecular Formula | C16H15BrFN |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-3,4-dihydro-2H-quinoline |
| SMILES | Fc1cc(Br)ccc1CN1CCCc2ccccc21 |
| InChI | InChI=1S/C16H15BrFN/c17-14-8-7-13(15(18)10-14)11-19-9-3-5-12-4-1-2-6-16(12)19/h1-2,4,6-8,10H,3,5,9,11H2 |
| InChIKey | GENTVKFIBXYTCQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |