3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid

C16H14FNO2 — CID 63074922

IUPAC3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(CN2CCc3ccccc32)c1
InChIInChI=1S/C16H14FNO2/c17-14-6-5-12(16(19)20)9-13(14)10-18-8-7-11-3-1-2-4-15(11)18/h1-6,9H,7-8,10H2,(H,19,20)
InChIKeyLYMUMQFIVAQXNB-UHFFFAOYSA-N
MW271.29 g/mol
LogP3.09
Rot. Bonds3

About 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid

3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid (PubChem CID 63074922) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid.

Molecular Properties

Compound Name3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid
PubChem CID63074922
Molecular FormulaC16H14FNO2
Molecular Weight271.29 g/mol
Exact Mass271.10
IUPAC Name3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(CN2CCc3ccccc32)c1
InChIInChI=1S/C16H14FNO2/c17-14-6-5-12(16(19)20)9-13(14)10-18-8-7-11-3-1-2-4-15(11)18/h1-6,9H,7-8,10H2,(H,19,20)
InChIKeyLYMUMQFIVAQXNB-UHFFFAOYSA-N
XLogP3.09
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.29
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid?
The IUPAC name of 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid (CID 63074922) is 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid.
What is the SMILES notation for 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid?
The canonical SMILES for 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid is O=C(O)c1ccc(F)c(CN2CCc3ccccc32)c1.
What is the InChIKey of 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid?
The InChIKey is LYMUMQFIVAQXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO2/c17-14-6-5-12(16(19)20)9-13(14)10-18-8-7-11-3-1-2-4-15(11)18/h1-6,9H,7-8,10H2,(H,19,20).
What are the key properties of 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid?
3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid has a molecular weight of 271.29 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroindol-1-ylmethyl)-4-fluorobenzoic acid is sourced from PubChem (CID 63074922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).