C13H13N3O2 — CID 117216569
4-(2,3-dihydroindol-1-ylmethyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117216569) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-ylmethyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-(2,3-dihydroindol-1-ylmethyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117216569 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-(2,3-dihydroindol-1-ylmethyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]ncc1CN1CCc2ccccc21 |
| InChI | InChI=1S/C13H13N3O2/c17-13(18)12-10(7-14-15-12)8-16-6-5-9-3-1-2-4-11(9)16/h1-4,7H,5-6,8H2,(H,14,15)(H,17,18) |
| InChIKey | IXIOEEZVYWFYJR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |