C18H18F3NO — CID 160670575
1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)-2,2,2-trifluoroethanol (PubChem CID 160670575) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 160670575 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc2c(c1)CCCN2Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO/c19-18(20,21)17(23)15-8-9-16-14(11-15)7-4-10-22(16)12-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,17,23H,4,7,10,12H2 |
| InChIKey | RMWLMWRPKKGMAW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|