C27H28F3NO4 — CID 154298724
1-[[1-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]-3,4-dihydro-2H-quinolin-6-yl]oxy]butan-2-ol (PubChem CID 154298724) has the molecular formula C27H28F3NO4 and a molecular weight of 487.52 g/mol. Its IUPAC name is 1-[[1-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]-3,4-dihydro-2H-quinolin-6-yl]oxy]butan-2-ol.
| Compound Name | 1-[[1-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]-3,4-dihydro-2H-quinolin-6-yl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 154298724 |
| Molecular Formula | C27H28F3NO4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 1-[[1-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]-3,4-dihydro-2H-quinolin-6-yl]oxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc2c(c1)CCCN2Cc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H28F3NO4/c1-2-21(32)18-33-25-13-14-26-20(16-25)4-3-15-31(26)17-19-5-7-22(8-6-19)34-23-9-11-24(12-10-23)35-27(28,29)30/h5-14,16,21,32H,2-4,15,17-18H2,1H3 |
| InChIKey | WRNPZKUZTJMKSV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|