C30H36ClN3O2 — CID 44589186
1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[4-(4-chlorophenyl)-2-methylpiperazin-1-yl]propan-2-ol (PubChem CID 44589186) has the molecular formula C30H36ClN3O2 and a molecular weight of 506.09 g/mol. Its IUPAC name is 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[4-(4-chlorophenyl)-2-methylpiperazin-1-yl]propan-2-ol.
| Compound Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[4-(4-chlorophenyl)-2-methylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 44589186 |
| Molecular Formula | C30H36ClN3O2 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 1-[(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)oxy]-3-[4-(4-chlorophenyl)-2-methylpiperazin-1-yl]propan-2-ol |
| SMILES | CC1CN(c2ccc(Cl)cc2)CCN1CC(O)COc1ccc2c(c1)CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C30H36ClN3O2/c1-23-19-33(27-11-9-26(31)10-12-27)17-16-32(23)21-28(35)22-36-29-13-14-30-25(18-29)8-5-15-34(30)20-24-6-3-2-4-7-24/h2-4,6-7,9-14,18,23,28,35H,5,8,15-17,19-22H2,1H3 |
| InChIKey | HPWUXBOOEFNNHT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|