C21H27ClN2O2 — CID 58328832
(2S)-1-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-3-(4-methylphenoxy)propan-2-ol (PubChem CID 58328832) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is (2S)-1-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 58328832 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2S)-1-[(2R)-4-(4-chlorophenyl)-2-methylpiperazin-1-yl]-3-(4-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OC[C@@H](O)CN2CCN(c3ccc(Cl)cc3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C21H27ClN2O2/c1-16-3-9-21(10-4-16)26-15-20(25)14-23-11-12-24(13-17(23)2)19-7-5-18(22)6-8-19/h3-10,17,20,25H,11-15H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | AUDCYHYLLSLAFW-XLIONFOSSA-N |
| XLogP | 3.60 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |