C21H29Cl3N2O3 — CID 14422870
1-(4-chlorophenoxy)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butan-2-ol;dihydrochloride (PubChem CID 14422870) has the molecular formula C21H29Cl3N2O3 and a molecular weight of 463.83 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butan-2-ol;dihydrochloride.
| Compound Name | 1-(4-chlorophenoxy)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 14422870 |
| Molecular Formula | C21H29Cl3N2O3 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1-(4-chlorophenoxy)-4-[4-(4-methoxyphenyl)piperazin-1-yl]butan-2-ol;dihydrochloride |
| SMILES | COc1ccc(N2CCN(CCC(O)COc3ccc(Cl)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C21H27ClN2O3.2ClH/c1-26-20-8-4-18(5-9-20)24-14-12-23(13-15-24)11-10-19(25)16-27-21-6-2-17(22)3-7-21;;/h2-9,19,25H,10-16H2,1H3;2*1H |
| InChIKey | HCOVZTTVGOLCDP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|