C23H32N2O5 — CID 15631758
1-phenoxy-4-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]butan-2-ol (PubChem CID 15631758) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-phenoxy-4-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]butan-2-ol.
| Compound Name | 1-phenoxy-4-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 15631758 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-phenoxy-4-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]butan-2-ol |
| SMILES | COc1cc(N2CCN(CCC(O)COc3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H32N2O5/c1-27-21-15-18(16-22(28-2)23(21)29-3)25-13-11-24(12-14-25)10-9-19(26)17-30-20-7-5-4-6-8-20/h4-8,15-16,19,26H,9-14,17H2,1-3H3 |
| InChIKey | XMTLRPUPJXEZSF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|