C28H40N3O5+ — CID 19787286
amino-[1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]-butoxycarbonyl-butoxycarbonyloxyazanium (PubChem CID 19787286) has the molecular formula C28H40N3O5+ and a molecular weight of 498.64 g/mol. Its IUPAC name is amino-[1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]-butoxycarbonyl-butoxycarbonyloxyazanium.
| Compound Name | amino-[1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]-butoxycarbonyl-butoxycarbonyloxyazanium |
|---|---|
| PubChem CID | 19787286 |
| Molecular Formula | C28H40N3O5+ |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | amino-[1-(1-benzyl-3,4-dihydro-2H-quinolin-6-yl)ethyl]-butoxycarbonyl-butoxycarbonyloxyazanium |
| SMILES | CCCCOC(=O)O[N+](N)(C(=O)OCCCC)C(C)c1ccc2c(c1)CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C28H40N3O5/c1-4-6-18-34-27(32)31(29,36-28(33)35-19-7-5-2)22(3)24-15-16-26-25(20-24)14-11-17-30(26)21-23-12-9-8-10-13-23/h8-10,12-13,15-16,20,22H,4-7,11,14,17-19,21,29H2,1-3H3/q+1 |
| InChIKey | QYZRCGZMDARFCL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|