C20H22N4O — CID 123808114
4-[[6-(1,3-diiminopropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methyl]benzamide (PubChem CID 123808114) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[[6-(1,3-diiminopropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methyl]benzamide.
| Compound Name | 4-[[6-(1,3-diiminopropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 123808114 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-[[6-(1,3-diiminopropan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methyl]benzamide |
| SMILES | [H]/N=C/C(/C=N/[H])c1ccc2c(c1)CCCN2Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H22N4O/c21-11-18(12-22)16-7-8-19-17(10-16)2-1-9-24(19)13-14-3-5-15(6-4-14)20(23)25/h3-8,10-12,18,21-22H,1-2,9,13H2,(H2,23,25)/b21-11+,22-12+ |
| InChIKey | NIQCMXIRSOCYRG-XHQRYOPUSA-N |
| XLogP | 3.12 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|