C19H21N — CID 46894465
1-benzyl-7-prop-1-en-2-yl-3,4-dihydro-2H-quinoline (PubChem CID 46894465) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-benzyl-7-prop-1-en-2-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-benzyl-7-prop-1-en-2-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 46894465 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-benzyl-7-prop-1-en-2-yl-3,4-dihydro-2H-quinoline |
| SMILES | C=C(C)c1ccc2c(c1)N(Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C19H21N/c1-15(2)18-11-10-17-9-6-12-20(19(17)13-18)14-16-7-4-3-5-8-16/h3-5,7-8,10-11,13H,1,6,9,12,14H2,2H3 |
| InChIKey | NQPNCRSPDMLGPY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |