C20H22BrNO — CID 166803449
8-bromo-1-[[4-(1-methoxyethenyl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 166803449) has the molecular formula C20H22BrNO and a molecular weight of 372.31 g/mol. Its IUPAC name is 8-bromo-1-[[4-(1-methoxyethenyl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 8-bromo-1-[[4-(1-methoxyethenyl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 166803449 |
| Molecular Formula | C20H22BrNO |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 8-bromo-1-[[4-(1-methoxyethenyl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | C=C(OC)c1ccc(CN2CCCCc3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C20H22BrNO/c1-15(23-2)17-8-6-16(7-9-17)14-22-12-4-3-5-18-10-11-19(21)13-20(18)22/h6-11,13H,1,3-5,12,14H2,2H3 |
| InChIKey | MZIWZYQUFAPKKK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|