C35H34Br3NO4 — CID 160973255
5-bromo-2,3-dihydro-1H-indene;methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate;methyl 4-(bromomethyl)benzoate (PubChem CID 160973255) has the molecular formula C35H34Br3NO4 and a molecular weight of 772.37 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1H-indene;methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate;methyl 4-(bromomethyl)benzoate.
| Compound Name | 5-bromo-2,3-dihydro-1H-indene;methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate;methyl 4-(bromomethyl)benzoate |
|---|---|
| PubChem CID | 160973255 |
| Molecular Formula | C35H34Br3NO4 |
| Molecular Weight | 772.37 g/mol |
| Exact Mass | 769.00 |
| IUPAC Name | 5-bromo-2,3-dihydro-1H-indene;methyl 4-[(5-bromo-2,3-dihydroindol-1-yl)methyl]benzoate;methyl 4-(bromomethyl)benzoate |
| SMILES | Brc1ccc2c(c1)CCC2.COC(=O)c1ccc(CBr)cc1.COC(=O)c1ccc(CN2CCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C17H16BrNO2.C9H9BrO2.C9H9Br/c1-21-17(20)13-4-2-12(3-5-13)11-19-9-8-14-10-15(18)6-7-16(14)19;1-12-9(11)8-4-2-7(6-10)3-5-8;10-9-5-4-7-2-1-3-8(7)6-9/h2-7,10H,8-9,11H2,1H3;2-5H,6H2,1H3;4-6H,1-3H2 |
| InChIKey | SYNNVLQSHNORCA-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.37 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|