C16H22BrNO — CID 175164732
8-bromo-1-(oxan-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 175164732) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 8-bromo-1-(oxan-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 8-bromo-1-(oxan-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 175164732 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 8-bromo-1-(oxan-4-ylmethyl)-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | Brc1ccc2c(c1)N(CC1CCOCC1)CCCC2 |
| InChI | InChI=1S/C16H22BrNO/c17-15-5-4-14-3-1-2-8-18(16(14)11-15)12-13-6-9-19-10-7-13/h4-5,11,13H,1-3,6-10,12H2 |
| InChIKey | KSUHFCQYHZBWEC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |