C12H18N2O — CID 82339274
(4-propyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanamine (PubChem CID 82339274) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (4-propyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanamine.
| Compound Name | (4-propyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanamine |
|---|---|
| PubChem CID | 82339274 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (4-propyl-2,3-dihydro-1,4-benzoxazin-7-yl)methanamine |
| SMILES | CCCN1CCOc2cc(CN)ccc21 |
| InChI | InChI=1S/C12H18N2O/c1-2-5-14-6-7-15-12-8-10(9-13)3-4-11(12)14/h3-4,8H,2,5-7,9,13H2,1H3 |
| InChIKey | LFISUILVRFZSJV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |