C18H22N2O — CID 59700590
N-benzyl-3-(2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine (PubChem CID 59700590) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-benzyl-3-(2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine.
| Compound Name | N-benzyl-3-(2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 59700590 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-benzyl-3-(2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine |
| SMILES | c1ccc(CNCCCN2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-2-7-16(8-3-1)15-19-11-6-12-20-13-14-21-18-10-5-4-9-17(18)20/h1-5,7-10,19H,6,11-15H2 |
| InChIKey | MSWQRLUGXFBENU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|